C31H40FNO2 — CID 11306103
(11S,17R)-17-fluoro-13-methyl-11-[4-(2-piperidin-1-ylethoxy)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 11306103) has the molecular formula C31H40FNO2 and a molecular weight of 477.66 g/mol. Its IUPAC name is (11S,17R)-17-fluoro-13-methyl-11-[4-(2-piperidin-1-ylethoxy)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (11S,17R)-17-fluoro-13-methyl-11-[4-(2-piperidin-1-ylethoxy)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 11306103 |
| Molecular Formula | C31H40FNO2 |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | (11S,17R)-17-fluoro-13-methyl-11-[4-(2-piperidin-1-ylethoxy)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC12C[C@@H](c3ccc(OCCN4CCCCC4)cc3)C3=C4CCC(=O)C=C4CCC3C1CC[C@H]2F |
| InChI | InChI=1S/C31H40FNO2/c1-31-20-27(21-5-9-24(10-6-21)35-18-17-33-15-3-2-4-16-33)30-25-12-8-23(34)19-22(25)7-11-26(30)28(31)13-14-29(31)32/h5-6,9-10,19,26-29H,2-4,7-8,11-18,20H2,1H3/t26?,27-,28?,29+,31?/m0/s1 |
| InChIKey | YPIFVVDBGIMMDV-AWLBGLRWSA-N |
| XLogP | 6.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |