C34H46O2 — CID 145342646
11-(4-tert-butylphenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3,3-dimethylbut-1-yne (PubChem CID 145342646) has the molecular formula C34H46O2 and a molecular weight of 486.74 g/mol. Its IUPAC name is 11-(4-tert-butylphenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3,3-dimethylbut-1-yne.
| Compound Name | 11-(4-tert-butylphenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3,3-dimethylbut-1-yne |
|---|---|
| PubChem CID | 145342646 |
| Molecular Formula | C34H46O2 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | 11-(4-tert-butylphenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3,3-dimethylbut-1-yne |
| SMILES | C#CC(C)(C)C.CC(C)(C)c1ccc(C2CC3(C)C(O)CCC3C3CCC4=CC(=O)CCC4=C23)cc1 |
| InChI | InChI=1S/C28H36O2.C6H10/c1-27(2,3)19-8-5-17(6-9-19)23-16-28(4)24(13-14-25(28)30)22-11-7-18-15-20(29)10-12-21(18)26(22)23;1-5-6(2,3)4/h5-6,8-9,15,22-25,30H,7,10-14,16H2,1-4H3;1H,2-4H3 |
| InChIKey | HHWDBZIFPQAIBU-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|