C32H41NO2S — CID 145342678
17-hydroxy-13-methyl-11-(4-piperidin-1-ylsulfanylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;prop-1-yne (PubChem CID 145342678) has the molecular formula C32H41NO2S and a molecular weight of 503.75 g/mol. Its IUPAC name is 17-hydroxy-13-methyl-11-(4-piperidin-1-ylsulfanylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;prop-1-yne.
| Compound Name | 17-hydroxy-13-methyl-11-(4-piperidin-1-ylsulfanylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;prop-1-yne |
|---|---|
| PubChem CID | 145342678 |
| Molecular Formula | C32H41NO2S |
| Molecular Weight | 503.75 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | 17-hydroxy-13-methyl-11-(4-piperidin-1-ylsulfanylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;prop-1-yne |
| SMILES | C#CC.CC12CC(c3ccc(SN4CCCCC4)cc3)C3=C4CCC(=O)C=C4CCC3C1CCC2O |
| InChI | InChI=1S/C29H37NO2S.C3H4/c1-29-18-25(19-5-9-22(10-6-19)33-30-15-3-2-4-16-30)28-23-12-8-21(31)17-20(23)7-11-24(28)26(29)13-14-27(29)32;1-3-2/h5-6,9-10,17,24-27,32H,2-4,7-8,11-16,18H2,1H3;1H,2H3 |
| InChIKey | RWMUGZBCBBOOTH-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.75 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|