C34H38O3 — CID 144863377
17-hydroxy-13-methyl-11-[4-(3-methylphenoxy)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;prop-1-yne (PubChem CID 144863377) has the molecular formula C34H38O3 and a molecular weight of 494.68 g/mol. Its IUPAC name is 17-hydroxy-13-methyl-11-[4-(3-methylphenoxy)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;prop-1-yne.
| Compound Name | 17-hydroxy-13-methyl-11-[4-(3-methylphenoxy)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;prop-1-yne |
|---|---|
| PubChem CID | 144863377 |
| Molecular Formula | C34H38O3 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 17-hydroxy-13-methyl-11-[4-(3-methylphenoxy)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;prop-1-yne |
| SMILES | C#CC.Cc1cccc(Oc2ccc(C3CC4(C)C(O)CCC4C4CCC5=CC(=O)CCC5=C34)cc2)c1 |
| InChI | InChI=1S/C31H34O3.C3H4/c1-19-4-3-5-24(16-19)34-23-10-6-20(7-11-23)27-18-31(2)28(14-15-29(31)33)26-12-8-21-17-22(32)9-13-25(21)30(26)27;1-3-2/h3-7,10-11,16-17,26-29,33H,8-9,12-15,18H2,1-2H3;1H,2H3 |
| InChIKey | UJHQZSTUXNHATN-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|