C34H36O3 — CID 118153150
(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-[4-(3-methylphenoxy)phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 118153150) has the molecular formula C34H36O3 and a molecular weight of 492.66 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-[4-(3-methylphenoxy)phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-[4-(3-methylphenoxy)phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 118153150 |
| Molecular Formula | C34H36O3 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-[4-(3-methylphenoxy)phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(Oc4cccc(C)c4)cc3)C[C@@]21C |
| InChI | InChI=1S/C34H36O3/c1-4-17-34(36)18-16-31-29-14-10-24-20-25(35)11-15-28(24)32(29)30(21-33(31,34)3)23-8-12-26(13-9-23)37-27-7-5-6-22(2)19-27/h5-9,12-13,19-20,29-31,36H,10-11,14-16,18,21H2,1-3H3/t29-,30+,31-,33-,34-/m0/s1 |
| InChIKey | QHTDCYCHKAZUME-FMHBTXFXSA-N |
| XLogP | 7.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|