C29H34FNO2 — CID 129307029
(8S,11R,13S,14S,17S)-11-[3-(dimethylamino)-4-fluorophenyl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129307029) has the molecular formula C29H34FNO2 and a molecular weight of 447.59 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-[3-(dimethylamino)-4-fluorophenyl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-[3-(dimethylamino)-4-fluorophenyl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129307029 |
| Molecular Formula | C29H34FNO2 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-[3-(dimethylamino)-4-fluorophenyl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(F)c(N(C)C)c3)C[C@@]21C |
| InChI | InChI=1S/C29H34FNO2/c1-5-13-29(33)14-12-24-22-9-6-18-15-20(32)8-10-21(18)27(22)23(17-28(24,29)2)19-7-11-25(30)26(16-19)31(3)4/h7,11,15-16,22-24,33H,6,8-10,12,14,17H2,1-4H3/t22-,23+,24-,28-,29-/m0/s1 |
| InChIKey | NAJCPRRJWIVCRB-DTBAVYRLSA-N |
| XLogP | 5.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|