C30H36O5 — CID 144902583
(8S)-17-hydroxy-13-methyl-17-prop-1-ynyl-11-(3,4,5-trimethoxyphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 144902583) has the molecular formula C30H36O5 and a molecular weight of 476.61 g/mol. Its IUPAC name is (8S)-17-hydroxy-13-methyl-17-prop-1-ynyl-11-(3,4,5-trimethoxyphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S)-17-hydroxy-13-methyl-17-prop-1-ynyl-11-(3,4,5-trimethoxyphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 144902583 |
| Molecular Formula | C30H36O5 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | (8S)-17-hydroxy-13-methyl-17-prop-1-ynyl-11-(3,4,5-trimethoxyphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC#CC1(O)CCC2[C@@H]3CCC4=CC(=O)CCC4=C3C(c3cc(OC)c(OC)c(OC)c3)CC21C |
| InChI | InChI=1S/C30H36O5/c1-6-12-30(32)13-11-24-22-9-7-18-14-20(31)8-10-21(18)27(22)23(17-29(24,30)2)19-15-25(33-3)28(35-5)26(16-19)34-4/h14-16,22-24,32H,7-11,13,17H2,1-5H3/t22-,23?,24?,29?,30?/m0/s1 |
| InChIKey | BGFDDYFXQASQNH-NVLGGLEBSA-N |
| XLogP | 5.37 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|