C27H31NO2 — CID 129306999
(8S,11S,13S,14S,17S)-17-hydroxy-13-methyl-11-(5-methyl-2-pyridinyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129306999) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is (8S,11S,13S,14S,17S)-17-hydroxy-13-methyl-11-(5-methyl-2-pyridinyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11S,13S,14S,17S)-17-hydroxy-13-methyl-11-(5-methyl-2-pyridinyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129306999 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (8S,11S,13S,14S,17S)-17-hydroxy-13-methyl-11-(5-methyl-2-pyridinyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(C)cn3)C[C@@]21C |
| InChI | InChI=1S/C27H31NO2/c1-4-12-27(30)13-11-23-21-8-6-18-14-19(29)7-9-20(18)25(21)22(15-26(23,27)3)24-10-5-17(2)16-28-24/h5,10,14,16,21-23,30H,6-9,11,13,15H2,1-3H3/t21-,22+,23-,26-,27-/m0/s1 |
| InChIKey | FRWVOHQPXGFYCA-VHXXJFIISA-N |
| XLogP | 5.04 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|