C28H32O2 — CID 13278691
17-hydroxy-13-methyl-11-(4-methylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 13278691) has the molecular formula C28H32O2 and a molecular weight of 400.56 g/mol. Its IUPAC name is 17-hydroxy-13-methyl-11-(4-methylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-hydroxy-13-methyl-11-(4-methylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 13278691 |
| Molecular Formula | C28H32O2 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 17-hydroxy-13-methyl-11-(4-methylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC#CC1(O)CCC2C3CCC4=CC(=O)CCC4=C3C(c3ccc(C)cc3)CC21C |
| InChI | InChI=1S/C28H32O2/c1-4-14-28(30)15-13-25-23-11-9-20-16-21(29)10-12-22(20)26(23)24(17-27(25,28)3)19-7-5-18(2)6-8-19/h5-8,16,23-25,30H,9-13,15,17H2,1-3H3 |
| InChIKey | RKGALGYSUZQRNO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|