C32H40FNO2 — CID 129304732
(8S,11R,13S,14S,17S)-11-[4-(dimethylamino)-3-fluorophenyl]-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304732) has the molecular formula C32H40FNO2 and a molecular weight of 489.68 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-[4-(dimethylamino)-3-fluorophenyl]-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-[4-(dimethylamino)-3-fluorophenyl]-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304732 |
| Molecular Formula | C32H40FNO2 |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-[4-(dimethylamino)-3-fluorophenyl]-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CN(C)c1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C#CC(C)(C)C)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1F |
| InChI | InChI=1S/C32H40FNO2/c1-30(2,3)15-16-32(36)14-13-26-24-10-7-20-17-22(35)9-11-23(20)29(24)25(19-31(26,32)4)21-8-12-28(34(5)6)27(33)18-21/h8,12,17-18,24-26,36H,7,9-11,13-14,19H2,1-6H3/t24-,25+,26-,31-,32+/m0/s1 |
| InChIKey | JHGKXRFVNJWDOZ-IOYPLIDVSA-N |
| XLogP | 6.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|