C32H39F2NO2 — CID 129304851
(8S,11S,13S,14S,17S)-11-[4-(dimethylamino)-2,3-difluorophenyl]-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304851) has the molecular formula C32H39F2NO2 and a molecular weight of 507.67 g/mol. Its IUPAC name is (8S,11S,13S,14S,17S)-11-[4-(dimethylamino)-2,3-difluorophenyl]-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11S,13S,14S,17S)-11-[4-(dimethylamino)-2,3-difluorophenyl]-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304851 |
| Molecular Formula | C32H39F2NO2 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | (8S,11S,13S,14S,17S)-11-[4-(dimethylamino)-2,3-difluorophenyl]-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CN(C)c1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C#CC(C)(C)C)[C@@H]3CCC4=CC(=O)CCC4=C32)c(F)c1F |
| InChI | InChI=1S/C32H39F2NO2/c1-30(2,3)15-16-32(37)14-13-25-23-9-7-19-17-20(36)8-10-21(19)27(23)24(18-31(25,32)4)22-11-12-26(35(5)6)29(34)28(22)33/h11-12,17,23-25,37H,7-10,13-14,18H2,1-6H3/t23-,24+,25-,31-,32+/m0/s1 |
| InChIKey | BZSUPYHHCDYLIP-OQDUGVJASA-N |
| XLogP | 6.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|