C34H36FNO2 — CID 67726307
(8S,11S,13S,14S,17S)-17-[2-[4-(dimethylamino)phenyl]ethynyl]-11-(2-fluorophenyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67726307) has the molecular formula C34H36FNO2 and a molecular weight of 509.67 g/mol. Its IUPAC name is (8S,11S,13S,14S,17S)-17-[2-[4-(dimethylamino)phenyl]ethynyl]-11-(2-fluorophenyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11S,13S,14S,17S)-17-[2-[4-(dimethylamino)phenyl]ethynyl]-11-(2-fluorophenyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67726307 |
| Molecular Formula | C34H36FNO2 |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | (8S,11S,13S,14S,17S)-17-[2-[4-(dimethylamino)phenyl]ethynyl]-11-(2-fluorophenyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CN(C)c1ccc(C#C[C@]2(O)CC[C@H]3[C@@H]4CCC5=CC(=O)CCC5=C4[C@@H](c4ccccc4F)C[C@@]32C)cc1 |
| InChI | InChI=1S/C34H36FNO2/c1-33-21-29(27-6-4-5-7-31(27)35)32-26-15-13-25(37)20-23(26)10-14-28(32)30(33)17-19-34(33,38)18-16-22-8-11-24(12-9-22)36(2)3/h4-9,11-12,20,28-30,38H,10,13-15,17,19,21H2,1-3H3/t28-,29+,30-,33-,34-/m0/s1 |
| InChIKey | GCBMOVAHKXTEKO-BWQSSOLDSA-N |
| XLogP | 6.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|