C35H37F2NO2 — CID 129304854
(8S,11R,13S,14S,17S)-11-(3,5-difluoro-4-methylphenyl)-17-[2-[4-(dimethylamino)phenyl]ethynyl]-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304854) has the molecular formula C35H37F2NO2 and a molecular weight of 541.68 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-(3,5-difluoro-4-methylphenyl)-17-[2-[4-(dimethylamino)phenyl]ethynyl]-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-(3,5-difluoro-4-methylphenyl)-17-[2-[4-(dimethylamino)phenyl]ethynyl]-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304854 |
| Molecular Formula | C35H37F2NO2 |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-(3,5-difluoro-4-methylphenyl)-17-[2-[4-(dimethylamino)phenyl]ethynyl]-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | Cc1c(F)cc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C#Cc3ccc(N(C)C)cc3)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1F |
| InChI | InChI=1S/C35H37F2NO2/c1-21-31(36)18-24(19-32(21)37)29-20-34(2)30(28-11-7-23-17-26(39)10-12-27(23)33(28)29)14-16-35(34,40)15-13-22-5-8-25(9-6-22)38(3)4/h5-6,8-9,17-19,28-30,40H,7,10-12,14,16,20H2,1-4H3/t28-,29+,30-,34-,35-/m0/s1 |
| InChIKey | LPWPPCKPSBTBNI-CTBBFHLNSA-N |
| XLogP | 7.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|