C35H39F2NO2 — CID 145342537
11-(3,5-difluoro-4-methylphenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;4-ethynyl-N,N-dimethylaniline (PubChem CID 145342537) has the molecular formula C35H39F2NO2 and a molecular weight of 543.70 g/mol. Its IUPAC name is 11-(3,5-difluoro-4-methylphenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;4-ethynyl-N,N-dimethylaniline.
| Compound Name | 11-(3,5-difluoro-4-methylphenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;4-ethynyl-N,N-dimethylaniline |
|---|---|
| PubChem CID | 145342537 |
| Molecular Formula | C35H39F2NO2 |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | 11-(3,5-difluoro-4-methylphenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;4-ethynyl-N,N-dimethylaniline |
| SMILES | C#Cc1ccc(N(C)C)cc1.Cc1c(F)cc(C2CC3(C)C(O)CCC3C3CCC4=CC(=O)CCC4=C23)cc1F |
| InChI | InChI=1S/C25H28F2O2.C10H11N/c1-13-21(26)10-15(11-22(13)27)19-12-25(2)20(7-8-23(25)29)18-5-3-14-9-16(28)4-6-17(14)24(18)19;1-4-9-5-7-10(8-6-9)11(2)3/h9-11,18-20,23,29H,3-8,12H2,1-2H3;1,5-8H,2-3H3 |
| InChIKey | LIBQLZOHQPILQO-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|