C29H32F2O2 — CID 145342474
11-(3,5-difluorophenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethynylcyclopropane (PubChem CID 145342474) has the molecular formula C29H32F2O2 and a molecular weight of 450.57 g/mol. Its IUPAC name is 11-(3,5-difluorophenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethynylcyclopropane.
| Compound Name | 11-(3,5-difluorophenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethynylcyclopropane |
|---|---|
| PubChem CID | 145342474 |
| Molecular Formula | C29H32F2O2 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 11-(3,5-difluorophenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethynylcyclopropane |
| SMILES | C#CC1CC1.CC12CC(c3cc(F)cc(F)c3)C3=C4CCC(=O)C=C4CCC3C1CCC2O |
| InChI | InChI=1S/C24H26F2O2.C5H6/c1-24-12-20(14-8-15(25)11-16(26)9-14)23-18-5-3-17(27)10-13(18)2-4-19(23)21(24)6-7-22(24)28;1-2-5-3-4-5/h8-11,19-22,28H,2-7,12H2,1H3;1,5H,3-4H2 |
| InChIKey | VNCQGVSRCSGWIK-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|