C31H36O4 — CID 145342612
11-(2,3-dihydro-1,4-benzodioxin-6-yl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethynylcyclopropane (PubChem CID 145342612) has the molecular formula C31H36O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is 11-(2,3-dihydro-1,4-benzodioxin-6-yl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethynylcyclopropane.
| Compound Name | 11-(2,3-dihydro-1,4-benzodioxin-6-yl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethynylcyclopropane |
|---|---|
| PubChem CID | 145342612 |
| Molecular Formula | C31H36O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 11-(2,3-dihydro-1,4-benzodioxin-6-yl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethynylcyclopropane |
| SMILES | C#CC1CC1.CC12CC(c3ccc4c(c3)OCCO4)C3=C4CCC(=O)C=C4CCC3C1CCC2O |
| InChI | InChI=1S/C26H30O4.C5H6/c1-26-14-20(16-3-8-22-23(13-16)30-11-10-29-22)25-18-6-4-17(27)12-15(18)2-5-19(25)21(26)7-9-24(26)28;1-2-5-3-4-5/h3,8,12-13,19-21,24,28H,2,4-7,9-11,14H2,1H3;1,5H,3-4H2 |
| InChIKey | XPHLZYCONMXGSH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|