C27H28O4 — CID 138626842
(8S,11R,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-16-ethynyl-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 138626842) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-16-ethynyl-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-16-ethynyl-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 138626842 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-16-ethynyl-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C#CC1C[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc4c(c3)OCO4)C[C@]2(C)[C@H]1O |
| InChI | InChI=1S/C27H28O4/c1-3-15-11-22-20-7-4-16-10-18(28)6-8-19(16)25(20)21(13-27(22,2)26(15)29)17-5-9-23-24(12-17)31-14-30-23/h1,5,9-10,12,15,20-22,26,29H,4,6-8,11,13-14H2,2H3/t15?,20-,21+,22-,26-,27-/m0/s1 |
| InChIKey | UVMZKBQGBMIJDQ-PRLHSQIESA-N |
| XLogP | 4.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|