C27H27ClO4 — CID 56982996
(8S,11R,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-17-(2-chloroethynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 56982996) has the molecular formula C27H27ClO4 and a molecular weight of 450.96 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-17-(2-chloroethynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-17-(2-chloroethynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 56982996 |
| Molecular Formula | C27H27ClO4 |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-17-(2-chloroethynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C[C@H](c3ccc4c(c3)OCO4)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@@]2(O)C#CCl |
| InChI | InChI=1S/C27H27ClO4/c1-26-14-21(17-3-7-23-24(13-17)32-15-31-23)25-19-6-4-18(29)12-16(19)2-5-20(25)22(26)8-9-27(26,30)10-11-28/h3,7,12-13,20-22,30H,2,4-6,8-9,14-15H2,1H3/t20-,21+,22-,26-,27+/m0/s1 |
| InChIKey | LIKODACUQBRIOE-KDPBODAISA-N |
| XLogP | 5.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|