C28H33NO3 — CID 135202031
(8S,11R,13S,14S,17S)-3-amino-11-(1,3-benzodioxol-5-yl)-13-methyl-17-prop-1-ynyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 135202031) has the molecular formula C28H33NO3 and a molecular weight of 431.58 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-3-amino-11-(1,3-benzodioxol-5-yl)-13-methyl-17-prop-1-ynyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8S,11R,13S,14S,17S)-3-amino-11-(1,3-benzodioxol-5-yl)-13-methyl-17-prop-1-ynyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 135202031 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (8S,11R,13S,14S,17S)-3-amino-11-(1,3-benzodioxol-5-yl)-13-methyl-17-prop-1-ynyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(N)CCC4=C3[C@@H](c3ccc4c(c3)OCO4)C[C@@]21C |
| InChI | InChI=1S/C28H33NO3/c1-3-11-28(30)12-10-23-21-7-4-17-13-19(29)6-8-20(17)26(21)22(15-27(23,28)2)18-5-9-24-25(14-18)32-16-31-24/h5,9,13-14,19,21-23,30H,4,6-8,10,12,15-16,29H2,1-2H3/t19?,21-,22+,23-,27-,28-/m0/s1 |
| InChIKey | LWXDKJUHSWICQM-RBRXQHQMSA-N |
| XLogP | 4.83 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|