C28H31NO3 — CID 123874380
11-(1,3-benzodioxol-5-yl)-3-imino-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 123874380) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is 11-(1,3-benzodioxol-5-yl)-3-imino-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | 11-(1,3-benzodioxol-5-yl)-3-imino-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 123874380 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 11-(1,3-benzodioxol-5-yl)-3-imino-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | [H]/N=C1\C=C2CCC3C(=C2CC1)C(c1ccc2c(c1)OCO2)CC1(C)C3CCC1(O)C#CC |
| InChI | InChI=1S/C28H31NO3/c1-3-11-28(30)12-10-23-21-7-4-17-13-19(29)6-8-20(17)26(21)22(15-27(23,28)2)18-5-9-24-25(14-18)32-16-31-24/h5,9,13-14,21-23,29-30H,4,6-8,10,12,15-16H2,1-2H3/b29-19- |
| InChIKey | QTIVNRLWGUAYSF-CEUNXORHSA-N |
| XLogP | 5.52 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|