C31H36O4 — CID 57251761
(8S,11R,13S,14S,17R)-11-(1,3-benzodioxol-5-yl)-17-hex-2-ynyl-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 57251761) has the molecular formula C31H36O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is (8S,11R,13S,14S,17R)-11-(1,3-benzodioxol-5-yl)-17-hex-2-ynyl-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17R)-11-(1,3-benzodioxol-5-yl)-17-hex-2-ynyl-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57251761 |
| Molecular Formula | C31H36O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (8S,11R,13S,14S,17R)-11-(1,3-benzodioxol-5-yl)-17-hex-2-ynyl-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCCC#CC[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc4c(c3)OCO4)C[C@@]21C |
| InChI | InChI=1S/C31H36O4/c1-3-4-5-6-14-31(33)15-13-26-24-10-7-20-16-22(32)9-11-23(20)29(24)25(18-30(26,31)2)21-8-12-27-28(17-21)35-19-34-27/h8,12,16-17,24-26,33H,3-4,7,9-11,13-15,18-19H2,1-2H3/t24-,25+,26-,30-,31-/m0/s1 |
| InChIKey | HEFHJXUCNOUAKW-XCBJYZPPSA-N |
| XLogP | 6.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|