C29H35N3O3S — CID 126612538
[[(8S,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-17-hydroxy-13-methyl-17-prop-1-ynyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]thiourea (PubChem CID 126612538) has the molecular formula C29H35N3O3S and a molecular weight of 505.68 g/mol. Its IUPAC name is [[(8S,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-17-hydroxy-13-methyl-17-prop-1-ynyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]thiourea.
| Compound Name | [[(8S,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-17-hydroxy-13-methyl-17-prop-1-ynyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]thiourea |
|---|---|
| PubChem CID | 126612538 |
| Molecular Formula | C29H35N3O3S |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | [[(8S,13S,14S,17S)-11-(1,3-benzodioxol-5-yl)-17-hydroxy-13-methyl-17-prop-1-ynyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]thiourea |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(NNC(N)=S)CCC4=C3C(c3ccc4c(c3)OCO4)C[C@@]21C |
| InChI | InChI=1S/C29H35N3O3S/c1-3-11-29(33)12-10-23-21-7-4-17-13-19(31-32-27(30)36)6-8-20(17)26(21)22(15-28(23,29)2)18-5-9-24-25(14-18)35-16-34-24/h5,9,13-14,19,21-23,31,33H,4,6-8,10,12,15-16H2,1-2H3,(H3,30,32,36)/t19?,21-,22?,23-,28-,29-/m0/s1 |
| InChIKey | HLUFEKHZAYEWCR-XZCHGKHCSA-N |
| XLogP | 4.21 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|