C29H37NO2 — CID 163071208
(3S,8S,11R,13S,14R,17R)-11-[4-(dimethylamino)phenyl]-13-methyl-17-prop-1-ynyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 163071208) has the molecular formula C29H37NO2 and a molecular weight of 431.62 g/mol. Its IUPAC name is (3S,8S,11R,13S,14R,17R)-11-[4-(dimethylamino)phenyl]-13-methyl-17-prop-1-ynyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (3S,8S,11R,13S,14R,17R)-11-[4-(dimethylamino)phenyl]-13-methyl-17-prop-1-ynyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 163071208 |
| Molecular Formula | C29H37NO2 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | (3S,8S,11R,13S,14R,17R)-11-[4-(dimethylamino)phenyl]-13-methyl-17-prop-1-ynyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CC#C[C@@]1(O)CC[C@@H]2[C@@H]3CCC4=C[C@@H](O)CCC4=C3[C@@H](c3ccc(N(C)C)cc3)C[C@@]21C |
| InChI | InChI=1S/C29H37NO2/c1-5-15-29(32)16-14-26-24-12-8-20-17-22(31)11-13-23(20)27(24)25(18-28(26,29)2)19-6-9-21(10-7-19)30(3)4/h6-7,9-10,17,22,24-26,31-32H,8,11-14,16,18H2,1-4H3/t22-,24-,25+,26+,28-,29+/m0/s1 |
| InChIKey | AYNSZTKDERUHKJ-PFFDTRPUSA-N |
| XLogP | 5.20 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|