C34H44N2O3 — CID 25233574
6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexanamide (PubChem CID 25233574) has the molecular formula C34H44N2O3 and a molecular weight of 528.74 g/mol. Its IUPAC name is 6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexanamide.
| Compound Name | 6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexanamide |
|---|---|
| PubChem CID | 25233574 |
| Molecular Formula | C34H44N2O3 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.34 |
| IUPAC Name | 6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexanamide |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N(C)CCCCCC(N)=O)cc3)C[C@@]21C |
| InChI | InChI=1S/C34H44N2O3/c1-4-18-34(39)19-17-30-28-15-11-24-21-26(37)14-16-27(24)32(28)29(22-33(30,34)2)23-9-12-25(13-10-23)36(3)20-7-5-6-8-31(35)38/h9-10,12-13,21,28-30,39H,5-8,11,14-17,19-20,22H2,1-3H3,(H2,35,38)/t28-,29+,30-,33-,34-/m0/s1 |
| InChIKey | MKGHLQVVVORFNA-BWQSSOLDSA-N |
| XLogP | 5.82 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|