C35H45NO4 — CID 25233572
methyl 6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexanoate (PubChem CID 25233572) has the molecular formula C35H45NO4 and a molecular weight of 543.75 g/mol. Its IUPAC name is methyl 6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexanoate.
| Compound Name | methyl 6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexanoate |
|---|---|
| PubChem CID | 25233572 |
| Molecular Formula | C35H45NO4 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | methyl 6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexanoate |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N(C)CCCCCC(=O)OC)cc3)C[C@@]21C |
| InChI | InChI=1S/C35H45NO4/c1-5-19-35(39)20-18-31-29-16-12-25-22-27(37)15-17-28(25)33(29)30(23-34(31,35)2)24-10-13-26(14-11-24)36(3)21-8-6-7-9-32(38)40-4/h10-11,13-14,22,29-31,39H,6-9,12,15-18,20-21,23H2,1-4H3/t29-,30+,31-,34-,35-/m0/s1 |
| InChIKey | DRGOQAUBBSLCDJ-WQQPUSSASA-N |
| XLogP | 6.51 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|