C33H43NO2 — CID 129304883
(8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-11-[4-[ethyl(methyl)amino]phenyl]-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304883) has the molecular formula C33H43NO2 and a molecular weight of 485.71 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-11-[4-[ethyl(methyl)amino]phenyl]-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-11-[4-[ethyl(methyl)amino]phenyl]-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304883 |
| Molecular Formula | C33H43NO2 |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | (8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-11-[4-[ethyl(methyl)amino]phenyl]-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCN(C)c1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C#CC(C)(C)C)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C33H43NO2/c1-7-34(6)24-11-8-22(9-12-24)28-21-32(5)29(16-17-33(32,36)19-18-31(2,3)4)27-14-10-23-20-25(35)13-15-26(23)30(27)28/h8-9,11-12,20,27-29,36H,7,10,13-17,21H2,1-6H3/t27-,28+,29-,32-,33+/m0/s1 |
| InChIKey | DOSKJMGZCCAOTF-QXQSKMGUSA-N |
| XLogP | 6.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|