C36H47NO2 — CID 129304785
(8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-11-[4-(1-methylpiperidin-4-yl)phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304785) has the molecular formula C36H47NO2 and a molecular weight of 525.78 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-11-[4-(1-methylpiperidin-4-yl)phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-11-[4-(1-methylpiperidin-4-yl)phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304785 |
| Molecular Formula | C36H47NO2 |
| Molecular Weight | 525.78 g/mol |
| Exact Mass | 525.36 |
| IUPAC Name | (8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-11-[4-(1-methylpiperidin-4-yl)phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CN1CCC(c2ccc([C@H]3C[C@@]4(C)[C@@H](CC[C@@]4(O)C#CC(C)(C)C)[C@@H]4CCC5=CC(=O)CCC5=C43)cc2)CC1 |
| InChI | InChI=1S/C36H47NO2/c1-34(2,3)18-19-36(39)17-14-32-30-12-10-27-22-28(38)11-13-29(27)33(30)31(23-35(32,36)4)26-8-6-24(7-9-26)25-15-20-37(5)21-16-25/h6-9,22,25,30-32,39H,10-17,20-21,23H2,1-5H3/t30-,31+,32-,35-,36+/m0/s1 |
| InChIKey | DWXKIDVVIXFRAJ-SSYXQGICSA-N |
| XLogP | 7.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.78 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|