C34H43NO4 — CID 129304708
(8S,11R,13S,14S,17S)-17-hydroxy-11-[4-(3-methoxyazetidin-1-yl)phenyl]-17-(3-methoxy-3-methylbut-1-ynyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304708) has the molecular formula C34H43NO4 and a molecular weight of 529.72 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-17-hydroxy-11-[4-(3-methoxyazetidin-1-yl)phenyl]-17-(3-methoxy-3-methylbut-1-ynyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-17-hydroxy-11-[4-(3-methoxyazetidin-1-yl)phenyl]-17-(3-methoxy-3-methylbut-1-ynyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304708 |
| Molecular Formula | C34H43NO4 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | (8S,11R,13S,14S,17S)-17-hydroxy-11-[4-(3-methoxyazetidin-1-yl)phenyl]-17-(3-methoxy-3-methylbut-1-ynyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | COC1CN(c2ccc([C@H]3C[C@@]4(C)[C@@H](CC[C@@]4(O)C#CC(C)(C)OC)[C@@H]4CCC5=CC(=O)CCC5=C43)cc2)C1 |
| InChI | InChI=1S/C34H43NO4/c1-32(2,39-5)16-17-34(37)15-14-30-28-12-8-23-18-25(36)11-13-27(23)31(28)29(19-33(30,34)3)22-6-9-24(10-7-22)35-20-26(21-35)38-4/h6-7,9-10,18,26,28-30,37H,8,11-15,19-21H2,1-5H3/t28-,29+,30-,33-,34+/m0/s1 |
| InChIKey | HWYZPFRAFYMXDY-GAXVQCDJSA-N |
| XLogP | 5.58 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|