C26H33NO2 — CID 54073976
(8S,13S,14R,17R)-11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 54073976) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is (8S,13S,14R,17R)-11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,13S,14R,17R)-11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 54073976 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | (8S,13S,14R,17R)-11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CN(C)c1ccc(C2C[C@]3(C)[C@H](O)CC[C@@H]3[C@@H]3CCC4=CC(=O)CCC4=C23)cc1 |
| InChI | InChI=1S/C26H33NO2/c1-26-15-22(16-4-7-18(8-5-16)27(2)3)25-20-11-9-19(28)14-17(20)6-10-21(25)23(26)12-13-24(26)29/h4-5,7-8,14,21-24,29H,6,9-13,15H2,1-3H3/t21-,22?,23+,24+,26-/m0/s1 |
| InChIKey | MIKHWEJAHFCGDK-ARAZTGDOSA-N |
| XLogP | 5.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|