C30H39NO2 — CID 143887786
17-but-3-enoxy-11-[4-(dimethylamino)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 143887786) has the molecular formula C30H39NO2 and a molecular weight of 445.65 g/mol. Its IUPAC name is 17-but-3-enoxy-11-[4-(dimethylamino)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-but-3-enoxy-11-[4-(dimethylamino)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 143887786 |
| Molecular Formula | C30H39NO2 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | 17-but-3-enoxy-11-[4-(dimethylamino)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C=CCCOC1CCC2C3CCC4=CC(=O)CCC4=C3C(c3ccc(N(C)C)cc3)CC12C |
| InChI | InChI=1S/C30H39NO2/c1-5-6-17-33-28-16-15-27-25-13-9-21-18-23(32)12-14-24(21)29(25)26(19-30(27,28)2)20-7-10-22(11-8-20)31(3)4/h5,7-8,10-11,18,25-28H,1,6,9,12-17,19H2,2-4H3 |
| InChIKey | OIAMXTNJCUDJEW-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|