C29H37NO2 — CID 67877411
(8S,11R,13S,14R)-11-[4-(dimethylamino)phenyl]-17-(3-hydroxypropyl)-13-methyl-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 67877411) has the molecular formula C29H37NO2 and a molecular weight of 431.62 g/mol. Its IUPAC name is (8S,11R,13S,14R)-11-[4-(dimethylamino)phenyl]-17-(3-hydroxypropyl)-13-methyl-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14R)-11-[4-(dimethylamino)phenyl]-17-(3-hydroxypropyl)-13-methyl-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67877411 |
| Molecular Formula | C29H37NO2 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | (8S,11R,13S,14R)-11-[4-(dimethylamino)phenyl]-17-(3-hydroxypropyl)-13-methyl-2,6,7,8,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CN(C)c1ccc([C@H]2C[C@]3(C)C(CCCO)=CC[C@@H]3[C@@H]3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C29H37NO2/c1-29-18-26(19-6-10-22(11-7-19)30(2)3)28-24-14-12-23(32)17-20(24)8-13-25(28)27(29)15-9-21(29)5-4-16-31/h6-7,9-11,17,25-27,31H,4-5,8,12-16,18H2,1-3H3/t25-,26+,27+,29+/m0/s1 |
| InChIKey | PVETUOHPANSPES-NFWVVERESA-N |
| XLogP | 5.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|