C30H41NO3 — CID 67877254
(8S,11R,13S,14R,17S)-11-[4-(dimethylamino)phenyl]-13-ethyl-17-hydroxy-17-(3-hydroxypropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67877254) has the molecular formula C30H41NO3 and a molecular weight of 463.66 g/mol. Its IUPAC name is (8S,11R,13S,14R,17S)-11-[4-(dimethylamino)phenyl]-13-ethyl-17-hydroxy-17-(3-hydroxypropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14R,17S)-11-[4-(dimethylamino)phenyl]-13-ethyl-17-hydroxy-17-(3-hydroxypropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67877254 |
| Molecular Formula | C30H41NO3 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | (8S,11R,13S,14R,17S)-11-[4-(dimethylamino)phenyl]-13-ethyl-17-hydroxy-17-(3-hydroxypropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC[C@]12C[C@H](c3ccc(N(C)C)cc3)C3=C4CCC(=O)C=C4CC[C@H]3[C@H]1CC[C@]2(O)CCCO |
| InChI | InChI=1S/C30H41NO3/c1-4-29-19-26(20-6-9-22(10-7-20)31(2)3)28-24-13-11-23(33)18-21(24)8-12-25(28)27(29)14-16-30(29,34)15-5-17-32/h6-7,9-10,18,25-27,32,34H,4-5,8,11-17,19H2,1-3H3/t25-,26+,27+,29-,30+/m0/s1 |
| InChIKey | NQVHRPPCMWYEPR-NARUKUFRSA-N |
| XLogP | 5.55 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|