C31H36O3S — CID 11755256
(13R,17S)-17-hydroxy-17-(3-hydroxypropyl)-13-methyl-11-(4-thiophen-3-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 11755256) has the molecular formula C31H36O3S and a molecular weight of 488.69 g/mol. Its IUPAC name is (13R,17S)-17-hydroxy-17-(3-hydroxypropyl)-13-methyl-11-(4-thiophen-3-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (13R,17S)-17-hydroxy-17-(3-hydroxypropyl)-13-methyl-11-(4-thiophen-3-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 11755256 |
| Molecular Formula | C31H36O3S |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | (13R,17S)-17-hydroxy-17-(3-hydroxypropyl)-13-methyl-11-(4-thiophen-3-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@]12CC(c3ccc(-c4ccsc4)cc3)C3=C4CCC(=O)C=C4CCC3C1CC[C@]2(O)CCCO |
| InChI | InChI=1S/C31H36O3S/c1-30-18-27(21-5-3-20(4-6-21)23-12-16-35-19-23)29-25-10-8-24(33)17-22(25)7-9-26(29)28(30)11-14-31(30,34)13-2-15-32/h3-6,12,16-17,19,26-28,32,34H,2,7-11,13-15,18H2,1H3/t26?,27?,28?,30-,31-/m1/s1 |
| InChIKey | BMHPZRRBARQPLM-ZTDHBNPBSA-N |
| XLogP | 6.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |