C30H38O4 — CID 10073067
(11R,13S,17R)-17-acetyl-17-(3-hydroxypropyl)-11-(4-methoxyphenyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 10073067) has the molecular formula C30H38O4 and a molecular weight of 462.63 g/mol. Its IUPAC name is (11R,13S,17R)-17-acetyl-17-(3-hydroxypropyl)-11-(4-methoxyphenyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S,17R)-17-acetyl-17-(3-hydroxypropyl)-11-(4-methoxyphenyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 10073067 |
| Molecular Formula | C30H38O4 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | (11R,13S,17R)-17-acetyl-17-(3-hydroxypropyl)-11-(4-methoxyphenyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | COc1ccc([C@H]2C[C@@]3(C)C(CC[C@]3(CCCO)C(C)=O)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C30H38O4/c1-19(32)30(14-4-16-31)15-13-27-25-11-7-21-17-22(33)8-12-24(21)28(25)26(18-29(27,30)2)20-5-9-23(34-3)10-6-20/h5-6,9-10,17,25-27,31H,4,7-8,11-16,18H2,1-3H3/t25?,26-,27?,29+,30-/m1/s1 |
| InChIKey | MCXYMTXGIJMXIV-ZVHIGBTLSA-N |
| XLogP | 5.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |