C27H32O5 — CID 23650949
4-[(8S,11R,13S,14S)-17-hydroxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoic acid (PubChem CID 23650949) has the molecular formula C27H32O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is 4-[(8S,11R,13S,14S)-17-hydroxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoic acid.
| Compound Name | 4-[(8S,11R,13S,14S)-17-hydroxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoic acid |
|---|---|
| PubChem CID | 23650949 |
| Molecular Formula | C27H32O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 4-[(8S,11R,13S,14S)-17-hydroxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoic acid |
| SMILES | COCC1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(C(=O)O)cc3)C[C@@]21C |
| InChI | InChI=1S/C27H32O5/c1-26-14-22(16-3-5-17(6-4-16)25(29)30)24-20-10-8-19(28)13-18(20)7-9-21(24)23(26)11-12-27(26,31)15-32-2/h3-6,13,21-23,31H,7-12,14-15H2,1-2H3,(H,29,30)/t21-,22+,23-,26-,27?/m0/s1 |
| InChIKey | JJDKQAUENOCLIS-HZHPMPLFSA-N |
| XLogP | 4.66 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |