C29H37NO4 — CID 10161883
(11R,17S)-17-hydroxy-11-[4-[(E)-hydroxyiminomethyl]phenyl]-13-methyl-17-(propan-2-yloxymethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 10161883) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is (11R,17S)-17-hydroxy-11-[4-[(E)-hydroxyiminomethyl]phenyl]-13-methyl-17-(propan-2-yloxymethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,17S)-17-hydroxy-11-[4-[(E)-hydroxyiminomethyl]phenyl]-13-methyl-17-(propan-2-yloxymethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 10161883 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | (11R,17S)-17-hydroxy-11-[4-[(E)-hydroxyiminomethyl]phenyl]-13-methyl-17-(propan-2-yloxymethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)OC[C@]1(O)CCC2C3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(/C=N/O)cc3)CC21C |
| InChI | InChI=1S/C29H37NO4/c1-18(2)34-17-29(32)13-12-26-24-10-8-21-14-22(31)9-11-23(21)27(24)25(15-28(26,29)3)20-6-4-19(5-7-20)16-30-33/h4-7,14,16,18,24-26,32-33H,8-13,15,17H2,1-3H3/b30-16+/t24?,25-,26?,28?,29-/m1/s1 |
| InChIKey | IKZYMYGJUMLZJG-JEJLZLTGSA-N |
| XLogP | 5.55 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|