C30H37NO6 — CID 12019164
[(E)-[4-[(8S,11R,13S,14S,17S)-17-methoxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylideneamino] methyl carbonate (PubChem CID 12019164) has the molecular formula C30H37NO6 and a molecular weight of 507.63 g/mol. Its IUPAC name is [(E)-[4-[(8S,11R,13S,14S,17S)-17-methoxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylideneamino] methyl carbonate.
| Compound Name | [(E)-[4-[(8S,11R,13S,14S,17S)-17-methoxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylideneamino] methyl carbonate |
|---|---|
| PubChem CID | 12019164 |
| Molecular Formula | C30H37NO6 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | [(E)-[4-[(8S,11R,13S,14S,17S)-17-methoxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylideneamino] methyl carbonate |
| SMILES | COC[C@]1(OC)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(/C=N/OC(=O)OC)cc3)C[C@@]21C |
| InChI | InChI=1S/C30H37NO6/c1-29-16-25(20-7-5-19(6-8-20)17-31-37-28(33)35-3)27-23-12-10-22(32)15-21(23)9-11-24(27)26(29)13-14-30(29,36-4)18-34-2/h5-8,15,17,24-26H,9-14,16,18H2,1-4H3/b31-17+/t24-,25+,26-,29-,30+/m0/s1 |
| InChIKey | YJLQASPYMPNOFH-ZHGBXDNRSA-N |
| XLogP | 5.73 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|