C29H37N3O3S — CID 87930403
[[4-[(11R,13S,17S)-17-methoxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylideneamino]thiourea (PubChem CID 87930403) has the molecular formula C29H37N3O3S and a molecular weight of 507.70 g/mol. Its IUPAC name is [[4-[(11R,13S,17S)-17-methoxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylideneamino]thiourea.
| Compound Name | [[4-[(11R,13S,17S)-17-methoxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 87930403 |
| Molecular Formula | C29H37N3O3S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | [[4-[(11R,13S,17S)-17-methoxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylideneamino]thiourea |
| SMILES | COC[C@]1(OC)CCC2C3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(C=NNC(N)=S)cc3)C[C@@]21C |
| InChI | InChI=1S/C29H37N3O3S/c1-28-15-24(19-6-4-18(5-7-19)16-31-32-27(30)36)26-22-11-9-21(33)14-20(22)8-10-23(26)25(28)12-13-29(28,35-3)17-34-2/h4-7,14,16,23-25H,8-13,15,17H2,1-3H3,(H3,30,32,36)/t23?,24-,25?,28+,29-/m1/s1 |
| InChIKey | DAPJXEPLXDCBTK-DCYZAUQCSA-N |
| XLogP | 4.78 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|