C27H32IO3- — CID 145492978
(11R,13S,17S)-17-hydroxy-11-[4-[(Z)-2-hydroxyiodanuidylethenyl]phenyl]-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 145492978) has the molecular formula C27H32IO3- and a molecular weight of 531.45 g/mol. Its IUPAC name is (11R,13S,17S)-17-hydroxy-11-[4-[(Z)-2-hydroxyiodanuidylethenyl]phenyl]-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S,17S)-17-hydroxy-11-[4-[(Z)-2-hydroxyiodanuidylethenyl]phenyl]-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 145492978 |
| Molecular Formula | C27H32IO3- |
| Molecular Weight | 531.45 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | (11R,13S,17S)-17-hydroxy-11-[4-[(Z)-2-hydroxyiodanuidylethenyl]phenyl]-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]1(O)CCC2C3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(/C=C\[I-]O)cc3)C[C@@]21C |
| InChI | InChI=1S/C27H32IO3/c1-26-16-23(18-5-3-17(4-6-18)12-14-28-31)25-21-10-8-20(29)15-19(21)7-9-22(25)24(26)11-13-27(26,2)30/h3-6,12,14-15,22-24,30-31H,7-11,13,16H2,1-2H3/q-1/b14-12-/t22?,23-,24?,26+,27+/m1/s1 |
| InChIKey | KHJAJPJBLFNYJQ-HNKXEASPSA-N |
| XLogP | 2.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|