C34H38O2S — CID 118312064
(11R,13S)-17-hydroxy-13,17-dimethyl-11-[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 118312064) has the molecular formula C34H38O2S and a molecular weight of 510.74 g/mol. Its IUPAC name is (11R,13S)-17-hydroxy-13,17-dimethyl-11-[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S)-17-hydroxy-13,17-dimethyl-11-[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 118312064 |
| Molecular Formula | C34H38O2S |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | (11R,13S)-17-hydroxy-13,17-dimethyl-11-[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CSc1ccc(/C=C/c2ccc([C@H]3C[C@@]4(C)C(CCC4(C)O)C4CCC5=CC(=O)CCC5=C43)cc2)cc1 |
| InChI | InChI=1S/C34H38O2S/c1-33-21-30(24-10-6-22(7-11-24)4-5-23-8-14-27(37-3)15-9-23)32-28-17-13-26(35)20-25(28)12-16-29(32)31(33)18-19-34(33,2)36/h4-11,14-15,20,29-31,36H,12-13,16-19,21H2,1-3H3/b5-4+/t29?,30-,31?,33+,34?/m1/s1 |
| InChIKey | QNFDXZDZOVCZKO-LXOVHTARSA-N |
| XLogP | 8.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|