C35H35F5O2S — CID 88985642
(11R)-17-hydroxy-13-methyl-11-[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88985642) has the molecular formula C35H35F5O2S and a molecular weight of 614.72 g/mol. Its IUPAC name is (11R)-17-hydroxy-13-methyl-11-[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R)-17-hydroxy-13-methyl-11-[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88985642 |
| Molecular Formula | C35H35F5O2S |
| Molecular Weight | 614.72 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | (11R)-17-hydroxy-13-methyl-11-[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CSc1ccc(/C=C/c2ccc([C@H]3CC4(C)C(CCC4(O)C(F)(F)C(F)(F)F)C4CCC5=CC(=O)CCC5=C43)cc2)cc1 |
| InChI | InChI=1S/C35H35F5O2S/c1-32-20-29(23-9-5-21(6-10-23)3-4-22-7-13-26(43-2)14-8-22)31-27-16-12-25(41)19-24(27)11-15-28(31)30(32)17-18-33(32,42)34(36,37)35(38,39)40/h3-10,13-14,19,28-30,42H,11-12,15-18,20H2,1-2H3/b4-3+/t28?,29-,30?,32?,33?/m1/s1 |
| InChIKey | GKUPAIZDEBISGB-MICCFWAOSA-N |
| XLogP | 9.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.72 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|