C32H30F6O2 — CID 87844992
(8S,11R,13S,14S,17S)-11-[4-(4-fluorophenyl)phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 87844992) has the molecular formula C32H30F6O2 and a molecular weight of 560.58 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-[4-(4-fluorophenyl)phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-[4-(4-fluorophenyl)phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 87844992 |
| Molecular Formula | C32H30F6O2 |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-[4-(4-fluorophenyl)phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C[C@H](c3ccc(-c4ccc(F)cc4)cc3)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H30F6O2/c1-29-17-26(20-4-2-18(3-5-20)19-6-9-22(33)10-7-19)28-24-13-11-23(39)16-21(24)8-12-25(28)27(29)14-15-30(29,40)31(34,35)32(36,37)38/h2-7,9-10,16,25-27,40H,8,11-15,17H2,1H3/t25-,26+,27-,29-,30-/m0/s1 |
| InChIKey | XSDBIABNXZZSKB-ZHAKMVSLSA-N |
| XLogP | 8.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|