C33H32F5NO3 — CID 53343490
4-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]benzamide (PubChem CID 53343490) has the molecular formula C33H32F5NO3 and a molecular weight of 585.61 g/mol. Its IUPAC name is 4-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]benzamide.
| Compound Name | 4-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 53343490 |
| Molecular Formula | C33H32F5NO3 |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | 4-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]benzamide |
| SMILES | C[C@]12C[C@H](c3ccc(-c4ccc(C(N)=O)cc4)cc3)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C33H32F5NO3/c1-30-17-26(20-6-2-18(3-7-20)19-4-8-21(9-5-19)29(39)41)28-24-13-11-23(40)16-22(24)10-12-25(28)27(30)14-15-31(30,42)32(34,35)33(36,37)38/h2-9,16,25-27,42H,10-15,17H2,1H3,(H2,39,41)/t25-,26+,27-,30-,31-/m0/s1 |
| InChIKey | KZLGSOOVVJOKNK-MJBQOYBXSA-N |
| XLogP | 7.28 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|