C36H33F5O4 — CID 88849718
methyl 4-[2-[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethynyl]benzoate (PubChem CID 88849718) has the molecular formula C36H33F5O4 and a molecular weight of 624.65 g/mol. Its IUPAC name is methyl 4-[2-[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethynyl]benzoate.
| Compound Name | methyl 4-[2-[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 88849718 |
| Molecular Formula | C36H33F5O4 |
| Molecular Weight | 624.65 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | methyl 4-[2-[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2ccc([C@H]3C[C@@]4(C)C(CC[C@@]4(O)C(F)(F)C(F)(F)F)C4CCC5=CC(=O)CCC5=C43)cc2)cc1 |
| InChI | InChI=1S/C36H33F5O4/c1-33-20-29(23-9-5-21(6-10-23)3-4-22-7-11-24(12-8-22)32(43)45-2)31-27-16-14-26(42)19-25(27)13-15-28(31)30(33)17-18-34(33,44)35(37,38)36(39,40)41/h5-12,19,28-30,44H,13-18,20H2,1-2H3/t28?,29-,30?,33+,34+/m1/s1 |
| InChIKey | AVVIKDHDMRHTAB-XZCXZHHQSA-N |
| XLogP | 7.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.65 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|