C33H33F5O4 — CID 88985723
ethyl (E)-5-[4-[(11R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]pent-2-en-4-ynoate (PubChem CID 88985723) has the molecular formula C33H33F5O4 and a molecular weight of 588.61 g/mol. Its IUPAC name is ethyl (E)-5-[4-[(11R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]pent-2-en-4-ynoate.
| Compound Name | ethyl (E)-5-[4-[(11R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]pent-2-en-4-ynoate |
|---|---|
| PubChem CID | 88985723 |
| Molecular Formula | C33H33F5O4 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | ethyl (E)-5-[4-[(11R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]pent-2-en-4-ynoate |
| SMILES | CCOC(=O)/C=C/C#Cc1ccc([C@H]2CC3(C)C(CCC3(O)C(F)(F)C(F)(F)F)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C33H33F5O4/c1-3-42-28(40)7-5-4-6-20-8-10-21(11-9-20)26-19-30(2)27(16-17-31(30,41)32(34,35)33(36,37)38)25-14-12-22-18-23(39)13-15-24(22)29(25)26/h5,7-11,18,25-27,41H,3,12-17,19H2,1-2H3/b7-5+/t25?,26-,27?,30?,31?/m1/s1 |
| InChIKey | VNMNXLATDKZVAG-NQFZBHLPSA-N |
| XLogP | 6.99 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|