C33H35F5O4 — CID 50996853
ethyl (2E,4E)-5-[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]penta-2,4-dienoate (PubChem CID 50996853) has the molecular formula C33H35F5O4 and a molecular weight of 590.63 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 50996853 |
| Molecular Formula | C33H35F5O4 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | ethyl (2E,4E)-5-[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/c1ccc([C@H]2C[C@@]3(C)C(CC[C@@]3(O)C(F)(F)C(F)(F)F)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C33H35F5O4/c1-3-42-28(40)7-5-4-6-20-8-10-21(11-9-20)26-19-30(2)27(16-17-31(30,41)32(34,35)33(36,37)38)25-14-12-22-18-23(39)13-15-24(22)29(25)26/h4-11,18,25-27,41H,3,12-17,19H2,1-2H3/b6-4+,7-5+/t25?,26-,27?,30+,31+/m1/s1 |
| InChIKey | YKPZEAJADQBXOE-POCPPSCDSA-N |
| XLogP | 7.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|