C29H32F5NO3 — CID 89438029
N-ethyl-4-[(11R,13S,17R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzamide (PubChem CID 89438029) has the molecular formula C29H32F5NO3 and a molecular weight of 537.57 g/mol. Its IUPAC name is N-ethyl-4-[(11R,13S,17R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzamide.
| Compound Name | N-ethyl-4-[(11R,13S,17R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzamide |
|---|---|
| PubChem CID | 89438029 |
| Molecular Formula | C29H32F5NO3 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | N-ethyl-4-[(11R,13S,17R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzamide |
| SMILES | CCNC(=O)c1ccc([C@H]2C[C@@]3(C)C(CC[C@]3(O)C(F)(F)C(F)(F)F)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C29H32F5NO3/c1-3-35-25(37)17-6-4-16(5-7-17)22-15-26(2)23(12-13-27(26,38)28(30,31)29(32,33)34)21-10-8-18-14-19(36)9-11-20(18)24(21)22/h4-7,14,21-23,38H,3,8-13,15H2,1-2H3,(H,35,37)/t21?,22-,23?,26+,27-/m1/s1 |
| InChIKey | BCLIZLIZTSDSGT-FWSVOTHISA-N |
| XLogP | 6.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|