C31H38F5NO2 — CID 89314576
(8S,11R,13S,14S,17R)-11-[4-(diethylaminomethyl)phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 89314576) has the molecular formula C31H38F5NO2 and a molecular weight of 551.64 g/mol. Its IUPAC name is (8S,11R,13S,14S,17R)-11-[4-(diethylaminomethyl)phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17R)-11-[4-(diethylaminomethyl)phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 89314576 |
| Molecular Formula | C31H38F5NO2 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | (8S,11R,13S,14S,17R)-11-[4-(diethylaminomethyl)phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCN(CC)Cc1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@]3(O)C(F)(F)C(F)(F)F)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C31H38F5NO2/c1-4-37(5-2)18-19-6-8-20(9-7-19)25-17-28(3)26(14-15-29(28,39)30(32,33)31(34,35)36)24-12-10-21-16-22(38)11-13-23(21)27(24)25/h6-9,16,24-26,39H,4-5,10-15,17-18H2,1-3H3/t24-,25+,26-,28-,29+/m0/s1 |
| InChIKey | UHOUYIQVFQILKH-QYQUYBGJSA-N |
| XLogP | 7.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|