C28H32F5NO4S — CID 123255624
4-[(11S,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 123255624) has the molecular formula C28H32F5NO4S and a molecular weight of 573.62 g/mol. Its IUPAC name is 4-[(11S,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[(11S,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 123255624 |
| Molecular Formula | C28H32F5NO4S |
| Molecular Weight | 573.62 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 4-[(11S,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc([C@@H]2C[C@@]3(C)C(CC[C@@]3(O)C(F)(F)C(F)(F)F)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C28H32F5NO4S/c1-25-15-22(16-4-8-19(9-5-16)39(37,38)34(2)3)24-20-11-7-18(35)14-17(20)6-10-21(24)23(25)12-13-26(25,36)27(29,30)28(31,32)33/h4-5,8-9,14,21-23,36H,6-7,10-13,15H2,1-3H3/t21?,22-,23?,25-,26-/m0/s1 |
| InChIKey | CQOAINFSBQXPGE-APXUFPSJSA-N |
| XLogP | 5.77 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|