C34H36F5NO4S — CID 148506994
4-[4-[(17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 148506994) has the molecular formula C34H36F5NO4S and a molecular weight of 649.72 g/mol. Its IUPAC name is 4-[4-[(17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[4-[(17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 148506994 |
| Molecular Formula | C34H36F5NO4S |
| Molecular Weight | 649.72 g/mol |
| Exact Mass | 649.23 |
| IUPAC Name | 4-[4-[(17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2ccc(C3CC4(C)C(CC[C@@]4(O)C(F)(F)C(F)(F)F)C4CCC5=CC(=O)CCC5=C34)cc2)cc1 |
| InChI | InChI=1S/C34H36F5NO4S/c1-31-19-28(22-6-4-20(5-7-22)21-8-12-25(13-9-21)45(43,44)40(2)3)30-26-15-11-24(41)18-23(26)10-14-27(30)29(31)16-17-32(31,42)33(35,36)34(37,38)39/h4-9,12-13,18,27-29,42H,10-11,14-17,19H2,1-3H3/t27?,28?,29?,31?,32-/m0/s1 |
| InChIKey | MLTPCSZFUWPHJB-XDDVCMKCSA-N |
| XLogP | 7.43 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.72 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|